C16H14FN5O3 — CID 3799825
1-(2-fluorophenyl)-3-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carbonyl)amino]urea (PubChem CID 3799825) has the molecular formula C16H14FN5O3 and a molecular weight of 343.32 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carbonyl)amino]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carbonyl)amino]urea |
|---|---|
| PubChem CID | 3799825 |
| Molecular Formula | C16H14FN5O3 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazole-5-carbonyl)amino]urea |
| SMILES | O=C(NNC(=O)C1CC(c2cccnc2)=NO1)Nc1ccccc1F |
| InChI | InChI=1S/C16H14FN5O3/c17-11-5-1-2-6-12(11)19-16(24)21-20-15(23)14-8-13(22-25-14)10-4-3-7-18-9-10/h1-7,9,14H,8H2,(H,20,23)(H2,19,21,24) |
| InChIKey | IZTRANCAMOZATB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|