C16H30O2 — CID 3800072
2-(4,8-dimethylnon-7-enyl)-2,4-dimethyl-1,3-dioxolane (PubChem CID 3800072) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 2-(4,8-dimethylnon-7-enyl)-2,4-dimethyl-1,3-dioxolane.
| Compound Name | 2-(4,8-dimethylnon-7-enyl)-2,4-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 3800072 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 2-(4,8-dimethylnon-7-enyl)-2,4-dimethyl-1,3-dioxolane |
| SMILES | CC(C)=CCCC(C)CCCC1(C)OCC(C)O1 |
| InChI | InChI=1S/C16H30O2/c1-13(2)8-6-9-14(3)10-7-11-16(5)17-12-15(4)18-16/h8,14-15H,6-7,9-12H2,1-5H3 |
| InChIKey | BGVNNNQAQXBIIC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|