C24H30N2O3 — CID 38004411
(2R)-2-(2,3-dimethylphenoxy)-N-[2-(piperidine-1-carbonyl)phenyl]butanamide (PubChem CID 38004411) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is (2R)-2-(2,3-dimethylphenoxy)-N-[2-(piperidine-1-carbonyl)phenyl]butanamide.
| Compound Name | (2R)-2-(2,3-dimethylphenoxy)-N-[2-(piperidine-1-carbonyl)phenyl]butanamide |
|---|---|
| PubChem CID | 38004411 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (2R)-2-(2,3-dimethylphenoxy)-N-[2-(piperidine-1-carbonyl)phenyl]butanamide |
| SMILES | CC[C@@H](Oc1cccc(C)c1C)C(=O)Nc1ccccc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C24H30N2O3/c1-4-21(29-22-14-10-11-17(2)18(22)3)23(27)25-20-13-7-6-12-19(20)24(28)26-15-8-5-9-16-26/h6-7,10-14,21H,4-5,8-9,15-16H2,1-3H3,(H,25,27)/t21-/m1/s1 |
| InChIKey | MKYANZFHWROAGW-OAQYLSRUSA-N |
| XLogP | 4.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |