C22H28N4O2 — CID 3800608
2-methylbutyl 2-amino-1-cyclohexylpyrrolo[3,2-b]quinoxaline-3-carboxylate (PubChem CID 3800608) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-methylbutyl 2-amino-1-cyclohexylpyrrolo[3,2-b]quinoxaline-3-carboxylate.
| Compound Name | 2-methylbutyl 2-amino-1-cyclohexylpyrrolo[3,2-b]quinoxaline-3-carboxylate |
|---|---|
| PubChem CID | 3800608 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-methylbutyl 2-amino-1-cyclohexylpyrrolo[3,2-b]quinoxaline-3-carboxylate |
| SMILES | CCC(C)COC(=O)c1c(N)n(C2CCCCC2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C22H28N4O2/c1-3-14(2)13-28-22(27)18-19-21(25-17-12-8-7-11-16(17)24-19)26(20(18)23)15-9-5-4-6-10-15/h7-8,11-12,14-15H,3-6,9-10,13,23H2,1-2H3 |
| InChIKey | GXBPIBOOLRKLEI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |