C20H25NO3S — CID 38007237
(2S)-N-[3-(2-methoxyphenyl)propyl]-2-(4-methoxyphenyl)sulfanylpropanamide (PubChem CID 38007237) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is (2S)-N-[3-(2-methoxyphenyl)propyl]-2-(4-methoxyphenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-[3-(2-methoxyphenyl)propyl]-2-(4-methoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 38007237 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (2S)-N-[3-(2-methoxyphenyl)propyl]-2-(4-methoxyphenyl)sulfanylpropanamide |
| SMILES | COc1ccc(S[C@@H](C)C(=O)NCCCc2ccccc2OC)cc1 |
| InChI | InChI=1S/C20H25NO3S/c1-15(25-18-12-10-17(23-2)11-13-18)20(22)21-14-6-8-16-7-4-5-9-19(16)24-3/h4-5,7,9-13,15H,6,8,14H2,1-3H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | LPGJAENTUVFKEQ-HNNXBMFYSA-N |
| XLogP | 3.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|