C15H8Cl3NO — CID 3800822
2-(2,3,4-trichlorophenyl)indolizine-3-carbaldehyde (PubChem CID 3800822) has the molecular formula C15H8Cl3NO and a molecular weight of 324.59 g/mol. Its IUPAC name is 2-(2,3,4-trichlorophenyl)indolizine-3-carbaldehyde.
| Compound Name | 2-(2,3,4-trichlorophenyl)indolizine-3-carbaldehyde |
|---|---|
| PubChem CID | 3800822 |
| Molecular Formula | C15H8Cl3NO |
| Molecular Weight | 324.59 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | 2-(2,3,4-trichlorophenyl)indolizine-3-carbaldehyde |
| SMILES | O=Cc1c(-c2ccc(Cl)c(Cl)c2Cl)cc2ccccn12 |
| InChI | InChI=1S/C15H8Cl3NO/c16-12-5-4-10(14(17)15(12)18)11-7-9-3-1-2-6-19(9)13(11)8-20/h1-8H |
| InChIKey | SXIYLYQYOYMLHJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 21.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|