C23H27N3O4S2 — CID 38010297
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide (PubChem CID 38010297) has the molecular formula C23H27N3O4S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 38010297 |
| Molecular Formula | C23H27N3O4S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide |
| SMILES | COc1ccc(CCN(C)C(=O)CSCc2nc3sc4c(c3c(=O)[nH]2)CCC4)cc1OC |
| InChI | InChI=1S/C23H27N3O4S2/c1-26(10-9-14-7-8-16(29-2)17(11-14)30-3)20(27)13-31-12-19-24-22(28)21-15-5-4-6-18(15)32-23(21)25-19/h7-8,11H,4-6,9-10,12-13H2,1-3H3,(H,24,25,28) |
| InChIKey | JVHVKUHKWJSQQO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |