C23H30N2O4S2 — CID 38016000
N-cyclopentyl-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-methylacetamide (PubChem CID 38016000) has the molecular formula C23H30N2O4S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is N-cyclopentyl-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-methylacetamide.
| Compound Name | N-cyclopentyl-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-methylacetamide |
|---|---|
| PubChem CID | 38016000 |
| Molecular Formula | C23H30N2O4S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-cyclopentyl-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-methylacetamide |
| SMILES | CCOc1ccccc1N(CC(=O)N(C)C1CCCC1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C23H30N2O4S2/c1-4-29-22-12-8-7-11-21(22)25(17-23(26)24(2)18-9-5-6-10-18)31(27,28)20-15-13-19(30-3)14-16-20/h7-8,11-16,18H,4-6,9-10,17H2,1-3H3 |
| InChIKey | NOPVZSGCEQMUBW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |