C22H29NO — CID 38016056
3-(4-tert-butylphenyl)-N-[(1R)-1-(4-methylphenyl)ethyl]propanamide (PubChem CID 38016056) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-[(1R)-1-(4-methylphenyl)ethyl]propanamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-[(1R)-1-(4-methylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 38016056 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-[(1R)-1-(4-methylphenyl)ethyl]propanamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)CCc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H29NO/c1-16-6-11-19(12-7-16)17(2)23-21(24)15-10-18-8-13-20(14-9-18)22(3,4)5/h6-9,11-14,17H,10,15H2,1-5H3,(H,23,24)/t17-/m1/s1 |
| InChIKey | LGWYVYLDNNRFIR-QGZVFWFLSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |