About ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate
ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate (PubChem CID 38018443) has the molecular formula C20H22F2N2O6S
and a molecular weight of 456.47 g/mol. Its IUPAC name is ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate |
| PubChem CID | 38018443 |
| Molecular Formula | C20H22F2N2O6S |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)NCc3cc(F)cc(F)c3)CC2)o1 |
| InChI | InChI=1S/C20H22F2N2O6S/c1-2-29-20(26)17-3-4-18(30-17)31(27,28)24-7-5-14(6-8-24)19(25)23-12-13-9-15(21)11-16(22)10-13/h3-4,9-11,14H,2,5-8,12H2,1H3,(H,23,25) |
| InChIKey | KYFHCGVOLYMHMW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate?
The IUPAC name of ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate (CID 38018443) is ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate.
What is the SMILES notation for ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate?
The canonical SMILES for ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate is CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)NCc3cc(F)cc(F)c3)CC2)o1.
What is the InChIKey of ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate?
The InChIKey is KYFHCGVOLYMHMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F2N2O6S/c1-2-29-20(26)17-3-4-18(30-17)31(27,28)24-7-5-14(6-8-24)19(25)23-12-13-9-15(21)11-16(22)10-13/h3-4,9-11,14H,2,5-8,12H2,1H3,(H,23,25).
What are the key properties of ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate?
ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate has a molecular weight of 456.47 g/mol, XLogP of 2.45, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[4-[(3,5-difluorophenyl)methylcarbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate is sourced from PubChem (CID 38018443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).