C18H28N4O3 — CID 38019279
(2E,4E)-N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butylhexa-2,4-dienamide (PubChem CID 38019279) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is (2E,4E)-N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butylhexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 38019279 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (2E,4E)-N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butylhexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)N(CCCC)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H28N4O3/c1-5-7-9-10-14(23)21(11-8-6-2)15-16(19)22(12-13(3)4)18(25)20-17(15)24/h5,7,9-10,13H,6,8,11-12,19H2,1-4H3,(H,20,24,25)/b7-5+,10-9+ |
| InChIKey | ZARGVGPPXYLXFU-GLVZAGOZSA-N |
| XLogP | 2.04 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|