C22H24N4OS — CID 38021535
N-(4-cyclopentylsulfanylphenyl)-5-ethyl-1-pyridin-2-ylpyrazole-4-carboxamide (PubChem CID 38021535) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is N-(4-cyclopentylsulfanylphenyl)-5-ethyl-1-pyridin-2-ylpyrazole-4-carboxamide.
| Compound Name | N-(4-cyclopentylsulfanylphenyl)-5-ethyl-1-pyridin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 38021535 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-(4-cyclopentylsulfanylphenyl)-5-ethyl-1-pyridin-2-ylpyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)Nc2ccc(SC3CCCC3)cc2)cnn1-c1ccccn1 |
| InChI | InChI=1S/C22H24N4OS/c1-2-20-19(15-24-26(20)21-9-5-6-14-23-21)22(27)25-16-10-12-18(13-11-16)28-17-7-3-4-8-17/h5-6,9-15,17H,2-4,7-8H2,1H3,(H,25,27) |
| InChIKey | RTDDRHCHCJANGN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |