C14H21FN4O2S — CID 38021661
4-fluoro-N-(3-pentyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)benzenesulfonamide (PubChem CID 38021661) has the molecular formula C14H21FN4O2S and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-fluoro-N-(3-pentyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(3-pentyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 38021661 |
| Molecular Formula | C14H21FN4O2S |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 4-fluoro-N-(3-pentyl-2,4-dihydro-1H-1,3,5-triazin-6-yl)benzenesulfonamide |
| SMILES | CCCCCN1CN=C(NS(=O)(=O)c2ccc(F)cc2)NC1 |
| InChI | InChI=1S/C14H21FN4O2S/c1-2-3-4-9-19-10-16-14(17-11-19)18-22(20,21)13-7-5-12(15)6-8-13/h5-8H,2-4,9-11H2,1H3,(H2,16,17,18) |
| InChIKey | UBWCPQPAVBCPQE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|