C15H9BrN4O3S2 — CID 3802184
9-(4-bromophenyl)-5,13-bis(sulfanylidene)-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-7,11-dione (PubChem CID 3802184) has the molecular formula C15H9BrN4O3S2 and a molecular weight of 437.30 g/mol. Its IUPAC name is 9-(4-bromophenyl)-5,13-bis(sulfanylidene)-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-7,11-dione.
| Compound Name | 9-(4-bromophenyl)-5,13-bis(sulfanylidene)-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-7,11-dione |
|---|---|
| PubChem CID | 3802184 |
| Molecular Formula | C15H9BrN4O3S2 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 435.93 |
| IUPAC Name | 9-(4-bromophenyl)-5,13-bis(sulfanylidene)-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-7,11-dione |
| SMILES | O=c1[nH]c(=S)[nH]c2c1C(c1ccc(Br)cc1)c1c([nH]c(=S)[nH]c1=O)O2 |
| InChI | InChI=1S/C15H9BrN4O3S2/c16-6-3-1-5(2-4-6)7-8-10(21)17-14(24)19-12(8)23-13-9(7)11(22)18-15(25)20-13/h1-4,7H,(H2,17,19,21,24)(H2,18,20,22,25) |
| InChIKey | ZTAHCRBSESSJBQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|