C15H10N6O3S — CID 38022058
4-methylsulfanyl-11-(2-nitrophenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 38022058) has the molecular formula C15H10N6O3S and a molecular weight of 354.35 g/mol. Its IUPAC name is 4-methylsulfanyl-11-(2-nitrophenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 4-methylsulfanyl-11-(2-nitrophenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 38022058 |
| Molecular Formula | C15H10N6O3S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 4-methylsulfanyl-11-(2-nitrophenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | CSc1nc2ncc3c(=O)n(-c4ccccc4[N+](=O)[O-])ccc3n2n1 |
| InChI | InChI=1S/C15H10N6O3S/c1-25-15-17-14-16-8-9-10(20(14)18-15)6-7-19(13(9)22)11-4-2-3-5-12(11)21(23)24/h2-8H,1H3 |
| InChIKey | WODZPCWVXUCCQW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 108.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|