C35H33N3O4 — CID 3802213
5-[2-(methylamino)ethyl]-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3802213) has the molecular formula C35H33N3O4 and a molecular weight of 559.67 g/mol. Its IUPAC name is 5-[2-(methylamino)ethyl]-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-[2-(methylamino)ethyl]-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3802213 |
| Molecular Formula | C35H33N3O4 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | 5-[2-(methylamino)ethyl]-3-(naphthalen-2-ylmethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CNCCN1C(=O)C2C(c3ccc(C=Cc4ccccc4)cc3)NC(Cc3ccc4ccccc4c3)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C35H33N3O4/c1-36-19-20-38-32(39)29-30(33(38)40)35(34(41)42,22-25-15-16-26-9-5-6-10-28(26)21-25)37-31(29)27-17-13-24(14-18-27)12-11-23-7-3-2-4-8-23/h2-18,21,29-31,36-37H,19-20,22H2,1H3,(H,41,42) |
| InChIKey | MJIHRPUMHAHXSJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|