About N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide
N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide (PubChem CID 38022798) has the molecular formula C14H22N4O2
and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide.
Molecular Properties
| Compound Name | N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide |
| PubChem CID | 38022798 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide |
| SMILES | Cc1cc(NC(=O)CCNC(=O)C2CCCC2)n(C)n1 |
| InChI | InChI=1S/C14H22N4O2/c1-10-9-12(18(2)17-10)16-13(19)7-8-15-14(20)11-5-3-4-6-11/h9,11H,3-8H2,1-2H3,(H,15,20)(H,16,19) |
| InChIKey | HYNCRIXZPRIMBU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide?
The IUPAC name of N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide (CID 38022798) is N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide.
What is the SMILES notation for N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide?
The canonical SMILES for N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide is Cc1cc(NC(=O)CCNC(=O)C2CCCC2)n(C)n1.
What is the InChIKey of N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide?
The InChIKey is HYNCRIXZPRIMBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O2/c1-10-9-12(18(2)17-10)16-13(19)7-8-15-14(20)11-5-3-4-6-11/h9,11H,3-8H2,1-2H3,(H,15,20)(H,16,19).
What are the key properties of N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide?
N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide has a molecular weight of 278.36 g/mol, XLogP of 1.36, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(2,5-dimethylpyrazol-3-yl)amino]-3-oxopropyl]cyclopentanecarboxamide is sourced from PubChem (CID 38022798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).