C17H34N2O6 — CID 38025827
(2S,3S,6S)-6-[2-[bis(2-methoxyethyl)amino]ethyl]-3-hydroxy-N-(2-methoxyethyl)oxane-2-carboxamide (PubChem CID 38025827) has the molecular formula C17H34N2O6 and a molecular weight of 362.47 g/mol. Its IUPAC name is (2S,3S,6S)-6-[2-[bis(2-methoxyethyl)amino]ethyl]-3-hydroxy-N-(2-methoxyethyl)oxane-2-carboxamide.
| Compound Name | (2S,3S,6S)-6-[2-[bis(2-methoxyethyl)amino]ethyl]-3-hydroxy-N-(2-methoxyethyl)oxane-2-carboxamide |
|---|---|
| PubChem CID | 38025827 |
| Molecular Formula | C17H34N2O6 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | (2S,3S,6S)-6-[2-[bis(2-methoxyethyl)amino]ethyl]-3-hydroxy-N-(2-methoxyethyl)oxane-2-carboxamide |
| SMILES | COCCNC(=O)[C@H]1O[C@H](CCN(CCOC)CCOC)CC[C@@H]1O |
| InChI | InChI=1S/C17H34N2O6/c1-22-11-7-18-17(21)16-15(20)5-4-14(25-16)6-8-19(9-12-23-2)10-13-24-3/h14-16,20H,4-13H2,1-3H3,(H,18,21)/t14-,15-,16-/m0/s1 |
| InChIKey | FEEOYLNMDSFMHB-JYJNAYRXSA-N |
| XLogP | -0.36 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|