C17H32N2O4S — CID 38027622
2-[(1S,4S,5S)-4-(methanesulfonamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 38027622) has the molecular formula C17H32N2O4S and a molecular weight of 360.52 g/mol. Its IUPAC name is 2-[(1S,4S,5S)-4-(methanesulfonamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(1S,4S,5S)-4-(methanesulfonamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 38027622 |
| Molecular Formula | C17H32N2O4S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 2-[(1S,4S,5S)-4-(methanesulfonamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@@H]1C[C@@H](C(C)C)[C@H](CNS(C)(=O)=O)C=C1C |
| InChI | InChI=1S/C17H32N2O4S/c1-12(2)16-9-14(10-17(20)18-6-7-23-4)13(3)8-15(16)11-19-24(5,21)22/h8,12,14-16,19H,6-7,9-11H2,1-5H3,(H,18,20)/t14-,15-,16-/m0/s1 |
| InChIKey | GBTRQKNDLRROIJ-JYJNAYRXSA-N |
| XLogP | 1.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|