C18H18Cl4N2O4S — CID 3802786
2-(4-chloro-2-methylphenoxy)-N-[2,2,2-trichloro-1-[(4-methylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 3802786) has the molecular formula C18H18Cl4N2O4S and a molecular weight of 500.23 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-[2,2,2-trichloro-1-[(4-methylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-[2,2,2-trichloro-1-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 3802786 |
| Molecular Formula | C18H18Cl4N2O4S |
| Molecular Weight | 500.23 g/mol |
| Exact Mass | 497.97 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-[2,2,2-trichloro-1-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(NC(=O)COc2ccc(Cl)cc2C)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C18H18Cl4N2O4S/c1-11-3-6-14(7-4-11)29(26,27)24-17(18(20,21)22)23-16(25)10-28-15-8-5-13(19)9-12(15)2/h3-9,17,24H,10H2,1-2H3,(H,23,25) |
| InChIKey | PTAJGENUOFRKAC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|