C25H36N2O3 — CID 38028219
4-methyl-N-[[(1S,4S,6S)-3-methyl-4-(2-morpholin-4-yl-2-oxoethyl)-6-propan-2-ylcyclohex-2-en-1-yl]methyl]benzamide (PubChem CID 38028219) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is 4-methyl-N-[[(1S,4S,6S)-3-methyl-4-(2-morpholin-4-yl-2-oxoethyl)-6-propan-2-ylcyclohex-2-en-1-yl]methyl]benzamide.
| Compound Name | 4-methyl-N-[[(1S,4S,6S)-3-methyl-4-(2-morpholin-4-yl-2-oxoethyl)-6-propan-2-ylcyclohex-2-en-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 38028219 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 4-methyl-N-[[(1S,4S,6S)-3-methyl-4-(2-morpholin-4-yl-2-oxoethyl)-6-propan-2-ylcyclohex-2-en-1-yl]methyl]benzamide |
| SMILES | CC1=C[C@@H](CNC(=O)c2ccc(C)cc2)[C@H](C(C)C)C[C@H]1CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H36N2O3/c1-17(2)23-14-21(15-24(28)27-9-11-30-12-10-27)19(4)13-22(23)16-26-25(29)20-7-5-18(3)6-8-20/h5-8,13,17,21-23H,9-12,14-16H2,1-4H3,(H,26,29)/t21-,22-,23-/m0/s1 |
| InChIKey | ZDXLQHKOJGCZOJ-VABKMULXSA-N |
| XLogP | 3.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|