C20H29NO4S — CID 38029554
2-[(1S,4S,5S)-4-[(benzylsulfonylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid (PubChem CID 38029554) has the molecular formula C20H29NO4S and a molecular weight of 379.52 g/mol. Its IUPAC name is 2-[(1S,4S,5S)-4-[(benzylsulfonylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid.
| Compound Name | 2-[(1S,4S,5S)-4-[(benzylsulfonylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 38029554 |
| Molecular Formula | C20H29NO4S |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-[(1S,4S,5S)-4-[(benzylsulfonylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid |
| SMILES | CC1=C[C@@H](CNS(=O)(=O)Cc2ccccc2)[C@H](C(C)C)C[C@H]1CC(=O)O |
| InChI | InChI=1S/C20H29NO4S/c1-14(2)19-10-17(11-20(22)23)15(3)9-18(19)12-21-26(24,25)13-16-7-5-4-6-8-16/h4-9,14,17-19,21H,10-13H2,1-3H3,(H,22,23)/t17-,18-,19-/m0/s1 |
| InChIKey | UIQLFVSJCKDAPF-FHWLQOOXSA-N |
| XLogP | 3.44 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|