C15H25NO3 — CID 38029656
2-[(1S,4S,5S)-4-(acetamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid (PubChem CID 38029656) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-[(1S,4S,5S)-4-(acetamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid.
| Compound Name | 2-[(1S,4S,5S)-4-(acetamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 38029656 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-[(1S,4S,5S)-4-(acetamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid |
| SMILES | CC(=O)NC[C@@H]1C=C(C)[C@H](CC(=O)O)C[C@H]1C(C)C |
| InChI | InChI=1S/C15H25NO3/c1-9(2)14-6-12(7-15(18)19)10(3)5-13(14)8-16-11(4)17/h5,9,12-14H,6-8H2,1-4H3,(H,16,17)(H,18,19)/t12-,13-,14-/m0/s1 |
| InChIKey | MORNLBKXSWESOG-IHRRRGAJSA-N |
| XLogP | 2.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|