C19H33NO3 — CID 38029677
2-[(1S,4S,5S)-4-[(3,3-dimethylbutanoylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid (PubChem CID 38029677) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is 2-[(1S,4S,5S)-4-[(3,3-dimethylbutanoylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid.
| Compound Name | 2-[(1S,4S,5S)-4-[(3,3-dimethylbutanoylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 38029677 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | 2-[(1S,4S,5S)-4-[(3,3-dimethylbutanoylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetic acid |
| SMILES | CC1=C[C@@H](CNC(=O)CC(C)(C)C)[C@H](C(C)C)C[C@H]1CC(=O)O |
| InChI | InChI=1S/C19H33NO3/c1-12(2)16-8-14(9-18(22)23)13(3)7-15(16)11-20-17(21)10-19(4,5)6/h7,12,14-16H,8-11H2,1-6H3,(H,20,21)(H,22,23)/t14-,15-,16-/m0/s1 |
| InChIKey | YXRPMXNNAQGWKU-JYJNAYRXSA-N |
| XLogP | 3.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|