C21H31NO4S — CID 38029736
ethyl 2-[(1S,4S,5S)-4-(benzenesulfonamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetate (PubChem CID 38029736) has the molecular formula C21H31NO4S and a molecular weight of 393.55 g/mol. Its IUPAC name is ethyl 2-[(1S,4S,5S)-4-(benzenesulfonamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetate.
| Compound Name | ethyl 2-[(1S,4S,5S)-4-(benzenesulfonamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 38029736 |
| Molecular Formula | C21H31NO4S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | ethyl 2-[(1S,4S,5S)-4-(benzenesulfonamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C[C@@H](C(C)C)[C@H](CNS(=O)(=O)c2ccccc2)C=C1C |
| InChI | InChI=1S/C21H31NO4S/c1-5-26-21(23)13-17-12-20(15(2)3)18(11-16(17)4)14-22-27(24,25)19-9-7-6-8-10-19/h6-11,15,17-18,20,22H,5,12-14H2,1-4H3/t17-,18-,20-/m0/s1 |
| InChIKey | ABLDZBMNYXWCST-BJLQDIEVSA-N |
| XLogP | 3.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|