C18H28N2O2 — CID 38029974
2-[(1S,4S,6S)-3-methyl-4-(2-morpholin-4-yl-2-oxoethyl)-6-propan-2-ylcyclohex-2-en-1-yl]acetonitrile (PubChem CID 38029974) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-[(1S,4S,6S)-3-methyl-4-(2-morpholin-4-yl-2-oxoethyl)-6-propan-2-ylcyclohex-2-en-1-yl]acetonitrile.
| Compound Name | 2-[(1S,4S,6S)-3-methyl-4-(2-morpholin-4-yl-2-oxoethyl)-6-propan-2-ylcyclohex-2-en-1-yl]acetonitrile |
|---|---|
| PubChem CID | 38029974 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-[(1S,4S,6S)-3-methyl-4-(2-morpholin-4-yl-2-oxoethyl)-6-propan-2-ylcyclohex-2-en-1-yl]acetonitrile |
| SMILES | CC1=C[C@@H](CC#N)[C@H](C(C)C)C[C@H]1CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H28N2O2/c1-13(2)17-11-16(14(3)10-15(17)4-5-19)12-18(21)20-6-8-22-9-7-20/h10,13,15-17H,4,6-9,11-12H2,1-3H3/t15-,16+,17+/m1/s1 |
| InChIKey | NNCCBWJMDFRLRS-IKGGRYGDSA-N |
| XLogP | 3.00 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|