C27H42N2O3 — CID 38031486
(2S)-2-[(1S,2S,4aS,7S,8S,8aS)-1-hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-tert-butylpropanamide (PubChem CID 38031486) has the molecular formula C27H42N2O3 and a molecular weight of 442.64 g/mol. Its IUPAC name is (2S)-2-[(1S,2S,4aS,7S,8S,8aS)-1-hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-tert-butylpropanamide.
| Compound Name | (2S)-2-[(1S,2S,4aS,7S,8S,8aS)-1-hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 38031486 |
| Molecular Formula | C27H42N2O3 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | (2S)-2-[(1S,2S,4aS,7S,8S,8aS)-1-hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-tert-butylpropanamide |
| SMILES | C[C@H]1[C@@H]2[C@@H](O)[C@H]([C@H](C)C(=O)NC(C)(C)C)CC[C@@]2(C)CC[C@@H]1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H42N2O3/c1-17(25(32)29-26(3,4)5)20-12-14-27(6)15-13-21(18(2)23(27)24(20)31)28-22(30)16-19-10-8-7-9-11-19/h7-11,17-18,20-21,23-24,31H,12-16H2,1-6H3,(H,28,30)(H,29,32)/t17-,18+,20-,21-,23+,24-,27-/m0/s1 |
| InChIKey | YPHBQXFAIJVVDD-GVGXLFMHSA-N |
| XLogP | 4.09 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |