C20H21ClN6 — CID 3804160
3-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 3804160) has the molecular formula C20H21ClN6 and a molecular weight of 380.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 3804160 |
| Molecular Formula | C20H21ClN6 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1cc(NCCCn2ccnc2)n2nc(C)c(-c3ccc(Cl)cc3)c2n1 |
| InChI | InChI=1S/C20H21ClN6/c1-14-12-18(23-8-3-10-26-11-9-22-13-26)27-20(24-14)19(15(2)25-27)16-4-6-17(21)7-5-16/h4-7,9,11-13,23H,3,8,10H2,1-2H3 |
| InChIKey | WOTGUOGOEKRSLA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 60.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|