C13H19BrN2 — CID 3804536
1-[1-(4-bromophenyl)ethyl]-1,4-diazepane (PubChem CID 3804536) has the molecular formula C13H19BrN2 and a molecular weight of 283.21 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)ethyl]-1,4-diazepane.
| Compound Name | 1-[1-(4-bromophenyl)ethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3804536 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-[1-(4-bromophenyl)ethyl]-1,4-diazepane |
| SMILES | CC(c1ccc(Br)cc1)N1CCCNCC1 |
| InChI | InChI=1S/C13H19BrN2/c1-11(12-3-5-13(14)6-4-12)16-9-2-7-15-8-10-16/h3-6,11,15H,2,7-10H2,1H3 |
| InChIKey | LCGXJKRBMXDNOM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |