C15H17FN4O2 — CID 38047231
N-(3-acetamidopropyl)-1-(4-fluorophenyl)pyrazole-3-carboxamide (PubChem CID 38047231) has the molecular formula C15H17FN4O2 and a molecular weight of 304.33 g/mol. Its IUPAC name is N-(3-acetamidopropyl)-1-(4-fluorophenyl)pyrazole-3-carboxamide.
| Compound Name | N-(3-acetamidopropyl)-1-(4-fluorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 38047231 |
| Molecular Formula | C15H17FN4O2 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-(3-acetamidopropyl)-1-(4-fluorophenyl)pyrazole-3-carboxamide |
| SMILES | CC(=O)NCCCNC(=O)c1ccn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H17FN4O2/c1-11(21)17-8-2-9-18-15(22)14-7-10-20(19-14)13-5-3-12(16)4-6-13/h3-7,10H,2,8-9H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | HGQLSICPKDKMKB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|