C17H22N4OS2 — CID 3804860
[2-oxo-2-(3-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylpiperazine-1-carbodithioate (PubChem CID 3804860) has the molecular formula C17H22N4OS2 and a molecular weight of 362.52 g/mol. Its IUPAC name is [2-oxo-2-(3-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylpiperazine-1-carbodithioate.
| Compound Name | [2-oxo-2-(3-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 3804860 |
| Molecular Formula | C17H22N4OS2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [2-oxo-2-(3-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylpiperazine-1-carbodithioate |
| SMILES | CN1CCN(C(=S)SCC(=O)N2N=CCC2c2ccccc2)CC1 |
| InChI | InChI=1S/C17H22N4OS2/c1-19-9-11-20(12-10-19)17(23)24-13-16(22)21-15(7-8-18-21)14-5-3-2-4-6-14/h2-6,8,15H,7,9-13H2,1H3 |
| InChIKey | QWWYQXAEEZBEBG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|