C35H28N4S — CID 3805207
4'-(2,5-dimethylphenyl)-2',3,5-triphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine] (PubChem CID 3805207) has the molecular formula C35H28N4S and a molecular weight of 536.70 g/mol. Its IUPAC name is 4'-(2,5-dimethylphenyl)-2',3,5-triphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine].
| Compound Name | 4'-(2,5-dimethylphenyl)-2',3,5-triphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine] |
|---|---|
| PubChem CID | 3805207 |
| Molecular Formula | C35H28N4S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 4'-(2,5-dimethylphenyl)-2',3,5-triphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine] |
| SMILES | Cc1ccc(C)c(C2=NN(c3ccccc3)C3(SC(c4ccccc4)=NN3c3ccccc3)c3ccccc32)c1 |
| InChI | InChI=1S/C35H28N4S/c1-25-22-23-26(2)31(24-25)33-30-20-12-13-21-32(30)35(38(36-33)28-16-8-4-9-17-28)39(29-18-10-5-11-19-29)37-34(40-35)27-14-6-3-7-15-27/h3-24H,1-2H3 |
| InChIKey | OXJCCTCEPOMQFT-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |