About 1-phenylundec-1-en-3-one
1-phenylundec-1-en-3-one (PubChem CID 3805572) has the molecular formula C17H24O
and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-phenylundec-1-en-3-one.
Molecular Properties
| Compound Name | 1-phenylundec-1-en-3-one |
| PubChem CID | 3805572 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-phenylundec-1-en-3-one |
| SMILES | CCCCCCCCC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C17H24O/c1-2-3-4-5-6-10-13-17(18)15-14-16-11-8-7-9-12-16/h7-9,11-12,14-15H,2-6,10,13H2,1H3 |
| InChIKey | IKJLIQNJILFDDF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylundec-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylundec-1-en-3-one?
The IUPAC name of 1-phenylundec-1-en-3-one (CID 3805572) is 1-phenylundec-1-en-3-one.
What is the SMILES notation for 1-phenylundec-1-en-3-one?
The canonical SMILES for 1-phenylundec-1-en-3-one is CCCCCCCCC(=O)C=Cc1ccccc1.
What is the InChIKey of 1-phenylundec-1-en-3-one?
The InChIKey is IKJLIQNJILFDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O/c1-2-3-4-5-6-10-13-17(18)15-14-16-11-8-7-9-12-16/h7-9,11-12,14-15H,2-6,10,13H2,1H3.
What are the key properties of 1-phenylundec-1-en-3-one?
1-phenylundec-1-en-3-one has a molecular weight of 244.38 g/mol, XLogP of 5.02, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylundec-1-en-3-one is sourced from PubChem (CID 3805572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).