C18H26N4O4 — CID 3805629
N-(1-amino-1-oxopropan-2-yl)-1-(1-methylpyrrole-2-carbonyl)-4-prop-2-enoxypiperidine-2-carboxamide (PubChem CID 3805629) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-(1-amino-1-oxopropan-2-yl)-1-(1-methylpyrrole-2-carbonyl)-4-prop-2-enoxypiperidine-2-carboxamide.
| Compound Name | N-(1-amino-1-oxopropan-2-yl)-1-(1-methylpyrrole-2-carbonyl)-4-prop-2-enoxypiperidine-2-carboxamide |
|---|---|
| PubChem CID | 3805629 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N-(1-amino-1-oxopropan-2-yl)-1-(1-methylpyrrole-2-carbonyl)-4-prop-2-enoxypiperidine-2-carboxamide |
| SMILES | C=CCOC1CCN(C(=O)c2cccn2C)C(C(=O)NC(C)C(N)=O)C1 |
| InChI | InChI=1S/C18H26N4O4/c1-4-10-26-13-7-9-22(18(25)14-6-5-8-21(14)3)15(11-13)17(24)20-12(2)16(19)23/h4-6,8,12-13,15H,1,7,9-11H2,2-3H3,(H2,19,23)(H,20,24) |
| InChIKey | CKOZUADOFYTAQK-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|