C8H2Cl2F5N3 — CID 3805723
8-chloro-3-[chloro(difluoro)methyl]-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 3805723) has the molecular formula C8H2Cl2F5N3 and a molecular weight of 306.02 g/mol. Its IUPAC name is 8-chloro-3-[chloro(difluoro)methyl]-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 8-chloro-3-[chloro(difluoro)methyl]-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 3805723 |
| Molecular Formula | C8H2Cl2F5N3 |
| Molecular Weight | 306.02 g/mol |
| Exact Mass | 304.95 |
| IUPAC Name | 8-chloro-3-[chloro(difluoro)methyl]-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | FC(F)(F)c1cc(Cl)c2nnc(C(F)(F)Cl)n2c1 |
| InChI | InChI=1S/C8H2Cl2F5N3/c9-4-1-3(8(13,14)15)2-18-5(4)16-17-6(18)7(10,11)12/h1-2H |
| InChIKey | UWFPWWFHGPKIAY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.02 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|