C27H42Cl3NO — CID 3806085
19,19,20-trichloro-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-10-ol (PubChem CID 3806085) has the molecular formula C27H42Cl3NO and a molecular weight of 503.00 g/mol. Its IUPAC name is 19,19,20-trichloro-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-10-ol.
| Compound Name | 19,19,20-trichloro-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-10-ol |
|---|---|
| PubChem CID | 3806085 |
| Molecular Formula | C27H42Cl3NO |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 19,19,20-trichloro-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-10-ol |
| SMILES | CC1CCC2N(C1)CC1C3CC4C(CCC5C(Cl)(Cl)C(Cl)CCC45C)C3CCC1C2(C)O |
| InChI | InChI=1S/C27H42Cl3NO/c1-15-4-9-24-26(3,32)20-7-5-16-17-6-8-22-25(2,11-10-23(28)27(22,29)30)21(17)12-18(16)19(20)14-31(24)13-15/h15-24,32H,4-14H2,1-3H3 |
| InChIKey | ODWXWMUBXIPATR-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|