C13H15N3O3 — CID 3806839
N-[(4-hydroxyphenyl)methylideneamino]-2-oxopiperidine-3-carboxamide (PubChem CID 3806839) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-[(4-hydroxyphenyl)methylideneamino]-2-oxopiperidine-3-carboxamide.
| Compound Name | N-[(4-hydroxyphenyl)methylideneamino]-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3806839 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-[(4-hydroxyphenyl)methylideneamino]-2-oxopiperidine-3-carboxamide |
| SMILES | O=C1NCCCC1C(=O)NN=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H15N3O3/c17-10-5-3-9(4-6-10)8-15-16-13(19)11-2-1-7-14-12(11)18/h3-6,8,11,17H,1-2,7H2,(H,14,18)(H,16,19) |
| InChIKey | FSSLKHARVGMDME-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|