About 3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine
3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine (PubChem CID 3806902) has the molecular formula C9H12N4O
and a molecular weight of 192.22 g/mol. Its IUPAC name is 3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
| PubChem CID | 3806902 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
| SMILES | CCCNc1ncnc2onc(C)c12 |
| InChI | InChI=1S/C9H12N4O/c1-3-4-10-8-7-6(2)13-14-9(7)12-5-11-8/h5H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | KGKKPMDAMDPNJB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine?
The IUPAC name of 3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine (CID 3806902) is 3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine.
What is the SMILES notation for 3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine?
The canonical SMILES for 3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine is CCCNc1ncnc2onc(C)c12.
What is the InChIKey of 3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine?
The InChIKey is KGKKPMDAMDPNJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O/c1-3-4-10-8-7-6(2)13-14-9(7)12-5-11-8/h5H,3-4H2,1-2H3,(H,10,11,12).
What are the key properties of 3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine?
3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine has a molecular weight of 192.22 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-amine is sourced from PubChem (CID 3806902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).