About 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one
2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one (PubChem CID 3807231) has the molecular formula C12H18ClN3O3S
and a molecular weight of 319.81 g/mol. Its IUPAC name is 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one |
| PubChem CID | 3807231 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one |
| SMILES | Cc1nn(C)c(Cl)c1C1SCC(=O)N1CCOCCO |
| InChI | InChI=1S/C12H18ClN3O3S/c1-8-10(11(13)15(2)14-8)12-16(9(18)7-20-12)3-5-19-6-4-17/h12,17H,3-7H2,1-2H3 |
| InChIKey | VQBJQXFQMYYBPP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one?
The IUPAC name of 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one (CID 3807231) is 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one is Cc1nn(C)c(Cl)c1C1SCC(=O)N1CCOCCO.
What is the InChIKey of 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one?
The InChIKey is VQBJQXFQMYYBPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN3O3S/c1-8-10(11(13)15(2)14-8)12-16(9(18)7-20-12)3-5-19-6-4-17/h12,17H,3-7H2,1-2H3.
What are the key properties of 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one?
2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one has a molecular weight of 319.81 g/mol, XLogP of 0.96, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-[2-(2-hydroxyethoxy)ethyl]-1,3-thiazolidin-4-one is sourced from PubChem (CID 3807231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).