About 2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol
2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol (PubChem CID 3807261) has the molecular formula C15H8Cl4N2O
and a molecular weight of 374.05 g/mol. Its IUPAC name is 2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol.
Molecular Properties
| Compound Name | 2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol |
| PubChem CID | 3807261 |
| Molecular Formula | C15H8Cl4N2O |
| Molecular Weight | 374.05 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | 2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1-c1cc(-c2ccc(Cl)cc2Cl)[nH]n1 |
| InChI | InChI=1S/C15H8Cl4N2O/c16-7-1-2-9(11(18)4-7)13-6-14(21-20-13)10-3-8(17)5-12(19)15(10)22/h1-6,22H,(H,20,21) |
| InChIKey | XBRORZXUXLMORZ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.05 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol?
The IUPAC name of 2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol (CID 3807261) is 2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol.
What is the SMILES notation for 2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol?
The canonical SMILES for 2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol is Oc1c(Cl)cc(Cl)cc1-c1cc(-c2ccc(Cl)cc2Cl)[nH]n1.
What is the InChIKey of 2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol?
The InChIKey is XBRORZXUXLMORZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8Cl4N2O/c16-7-1-2-9(11(18)4-7)13-6-14(21-20-13)10-3-8(17)5-12(19)15(10)22/h1-6,22H,(H,20,21).
What are the key properties of 2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol?
2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol has a molecular weight of 374.05 g/mol, XLogP of 6.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-6-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]phenol is sourced from PubChem (CID 3807261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).