C16H13N3O — CID 38072631
(E)-N-[4-(cyanomethyl)phenyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 38072631) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is (E)-N-[4-(cyanomethyl)phenyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[4-(cyanomethyl)phenyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 38072631 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (E)-N-[4-(cyanomethyl)phenyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | N#CCc1ccc(NC(=O)/C=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C16H13N3O/c17-10-9-13-3-6-15(7-4-13)19-16(20)8-5-14-2-1-11-18-12-14/h1-8,11-12H,9H2,(H,19,20)/b8-5+ |
| InChIKey | ZOHKFUVBTWSBJK-VMPITWQZSA-N |
| XLogP | 2.80 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|