About 7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine
7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine (PubChem CID 3807425) has the molecular formula C13H5Cl2F3N4O3
and a molecular weight of 393.11 g/mol. Its IUPAC name is 7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine.
Molecular Properties
| Compound Name | 7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine |
| PubChem CID | 3807425 |
| Molecular Formula | C13H5Cl2F3N4O3 |
| Molecular Weight | 393.11 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | 7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cc(C(F)(F)F)ccc2Cl)cc(Cl)c2nonc12 |
| InChI | InChI=1S/C13H5Cl2F3N4O3/c14-6-2-1-5(13(16,17)18)3-8(6)19-9-4-7(15)10-11(21-25-20-10)12(9)22(23)24/h1-4,19H |
| InChIKey | YHGALULLPDGAJF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.11 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine?
The IUPAC name of 7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine (CID 3807425) is 7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine.
What is the SMILES notation for 7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine?
The canonical SMILES for 7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine is O=[N+]([O-])c1c(Nc2cc(C(F)(F)F)ccc2Cl)cc(Cl)c2nonc12.
What is the InChIKey of 7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine?
The InChIKey is YHGALULLPDGAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H5Cl2F3N4O3/c14-6-2-1-5(13(16,17)18)3-8(6)19-9-4-7(15)10-11(21-25-20-10)12(9)22(23)24/h1-4,19H.
What are the key properties of 7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine?
7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine has a molecular weight of 393.11 g/mol, XLogP of 5.20, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-nitro-2,1,3-benzoxadiazol-5-amine is sourced from PubChem (CID 3807425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).