C15H16F3N3O2 — CID 3807441
N-(3-imidazol-1-ylpropyl)-4-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 3807441) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-4-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-4-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 3807441 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-4-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H16F3N3O2/c16-15(17,18)10-23-13-4-2-12(3-5-13)14(22)20-6-1-8-21-9-7-19-11-21/h2-5,7,9,11H,1,6,8,10H2,(H,20,22) |
| InChIKey | XYMIPOQVXFPVIU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|