C22H22N2OS — CID 3807651
1-(2,2-diphenylethyl)-3-(3-methylsulfanylphenyl)urea (PubChem CID 3807651) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-(2,2-diphenylethyl)-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 3807651 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-(2,2-diphenylethyl)-3-(3-methylsulfanylphenyl)urea |
| SMILES | CSc1cccc(NC(=O)NCC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H22N2OS/c1-26-20-14-8-13-19(15-20)24-22(25)23-16-21(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-15,21H,16H2,1H3,(H2,23,24,25) |
| InChIKey | HRZWRFHZYPDOCH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |