C13H11ClF3N3OS — CID 3808002
1-[5-(4-chlorophenyl)sulfanyl-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-N-methoxymethanimine (PubChem CID 3808002) has the molecular formula C13H11ClF3N3OS and a molecular weight of 349.77 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)sulfanyl-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-N-methoxymethanimine.
| Compound Name | 1-[5-(4-chlorophenyl)sulfanyl-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 3808002 |
| Molecular Formula | C13H11ClF3N3OS |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 1-[5-(4-chlorophenyl)sulfanyl-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-N-methoxymethanimine |
| SMILES | CON=Cc1c(C(F)(F)F)nn(C)c1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H11ClF3N3OS/c1-20-12(22-9-5-3-8(14)4-6-9)10(7-18-21-2)11(19-20)13(15,16)17/h3-7H,1-2H3 |
| InChIKey | TYESXVDRMQZDAU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|