About 4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole
4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole (PubChem CID 3808119) has the molecular formula C17H17N3O
and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole |
| PubChem CID | 3808119 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole |
| SMILES | COc1ccc2c(c1)N1CCN=C1N2Cc1ccccc1 |
| InChI | InChI=1S/C17H17N3O/c1-21-14-7-8-15-16(11-14)19-10-9-18-17(19)20(15)12-13-5-3-2-4-6-13/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | QVUZOFRVOWRBKK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole?
The IUPAC name of 4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole (CID 3808119) is 4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole.
What is the SMILES notation for 4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole?
The canonical SMILES for 4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole is COc1ccc2c(c1)N1CCN=C1N2Cc1ccccc1.
What is the InChIKey of 4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole?
The InChIKey is QVUZOFRVOWRBKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O/c1-21-14-7-8-15-16(11-14)19-10-9-18-17(19)20(15)12-13-5-3-2-4-6-13/h2-8,11H,9-10,12H2,1H3.
What are the key properties of 4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole?
4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole has a molecular weight of 279.34 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-7-methoxy-1,2-dihydroimidazo[1,2-a]benzimidazole is sourced from PubChem (CID 3808119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).