C27H22N2O4S — CID 3808162
propan-2-yl 2,3-dioxo-1,10a-diphenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-4-carboxylate (PubChem CID 3808162) has the molecular formula C27H22N2O4S and a molecular weight of 470.55 g/mol. Its IUPAC name is propan-2-yl 2,3-dioxo-1,10a-diphenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-4-carboxylate.
| Compound Name | propan-2-yl 2,3-dioxo-1,10a-diphenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-4-carboxylate |
|---|---|
| PubChem CID | 3808162 |
| Molecular Formula | C27H22N2O4S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | propan-2-yl 2,3-dioxo-1,10a-diphenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-4-carboxylate |
| SMILES | CC(C)OC(=O)C1=C2C(=O)C(=O)N(c3ccccc3)C2(c2ccccc2)Sc2ccccc2N1 |
| InChI | InChI=1S/C27H22N2O4S/c1-17(2)33-26(32)23-22-24(30)25(31)29(19-13-7-4-8-14-19)27(22,18-11-5-3-6-12-18)34-21-16-10-9-15-20(21)28-23/h3-17,28H,1-2H3 |
| InChIKey | XKOCTEDSCXLXAW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|