About 2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol
2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol (PubChem CID 3808173) has the molecular formula C18H21Cl2NO
and a molecular weight of 338.28 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol.
Molecular Properties
| Compound Name | 2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol |
| PubChem CID | 3808173 |
| Molecular Formula | C18H21Cl2NO |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol |
| SMILES | CCC(C)NCC(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21Cl2NO/c1-3-13(2)21-12-18(22,14-4-8-16(19)9-5-14)15-6-10-17(20)11-7-15/h4-11,13,21-22H,3,12H2,1-2H3 |
| InChIKey | BQRBPWDQFAYRAI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol?
The IUPAC name of 2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol (CID 3808173) is 2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol.
What is the SMILES notation for 2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol?
The canonical SMILES for 2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol is CCC(C)NCC(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1.
What is the InChIKey of 2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol?
The InChIKey is BQRBPWDQFAYRAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21Cl2NO/c1-3-13(2)21-12-18(22,14-4-8-16(19)9-5-14)15-6-10-17(20)11-7-15/h4-11,13,21-22H,3,12H2,1-2H3.
What are the key properties of 2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol?
2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol has a molecular weight of 338.28 g/mol, XLogP of 4.62, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butan-2-ylamino)-1,1-bis(4-chlorophenyl)ethanol is sourced from PubChem (CID 3808173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).