C13H22N4S2+2 — CID 3808179
[amino-[[3-[[amino(azaniumylidene)methyl]sulfanylmethyl]-2,4,6-trimethylphenyl]methylsulfanyl]methylidene]azanium (PubChem CID 3808179) has the molecular formula C13H22N4S2+2 and a molecular weight of 298.48 g/mol. Its IUPAC name is [amino-[[3-[[amino(azaniumylidene)methyl]sulfanylmethyl]-2,4,6-trimethylphenyl]methylsulfanyl]methylidene]azanium.
| Compound Name | [amino-[[3-[[amino(azaniumylidene)methyl]sulfanylmethyl]-2,4,6-trimethylphenyl]methylsulfanyl]methylidene]azanium |
|---|---|
| PubChem CID | 3808179 |
| Molecular Formula | C13H22N4S2+2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | [amino-[[3-[[amino(azaniumylidene)methyl]sulfanylmethyl]-2,4,6-trimethylphenyl]methylsulfanyl]methylidene]azanium |
| SMILES | Cc1cc(C)c(CSC(N)=[NH2+])c(C)c1CSC(N)=[NH2+] |
| InChI | InChI=1S/C13H20N4S2/c1-7-4-8(2)11(6-19-13(16)17)9(3)10(7)5-18-12(14)15/h4H,5-6H2,1-3H3,(H3,14,15)(H3,16,17)/p+2 |
| InChIKey | JTFHJACDFMAMNL-UHFFFAOYSA-P |
| XLogP | -0.77 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|