C14H23NSi — CID 3808194
trimethyl-[(8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methyl]silane (PubChem CID 3808194) has the molecular formula C14H23NSi and a molecular weight of 233.43 g/mol. Its IUPAC name is trimethyl-[(8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methyl]silane.
| Compound Name | trimethyl-[(8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methyl]silane |
|---|---|
| PubChem CID | 3808194 |
| Molecular Formula | C14H23NSi |
| Molecular Weight | 233.43 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | trimethyl-[(8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methyl]silane |
| SMILES | Cc1cccc2c1NCCC2C[Si](C)(C)C |
| InChI | InChI=1S/C14H23NSi/c1-11-6-5-7-13-12(10-16(2,3)4)8-9-15-14(11)13/h5-7,12,15H,8-10H2,1-4H3 |
| InChIKey | CGPGAYGYHVSHQB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|